93680-80-9 Usage
Description
3-Acetoxybenzofuran, also known as 3-Acetoxybenzo[b]furan, is a chemical compound characterized by its clear light yellow liquid appearance. It serves as a valuable intermediate in the synthesis of a range of pharmaceutically and biologically active compounds, making it a crucial component in the development of new drugs and therapies.
Uses
Used in Pharmaceutical Industry:
3-Acetoxybenzofuran is used as a key intermediate for the synthesis of various pharmaceutically active compounds. Its role in the creation of these compounds is essential, as it contributes to the development of new medications and treatments for a variety of health conditions.
Used in Biological Research:
In the field of biological research, 3-Acetoxybenzofuran is utilized as a precursor in the synthesis of biologically active compounds. This allows scientists to explore its potential applications in understanding biological processes and developing targeted therapies for specific diseases.
Overall, 3-Acetoxybenzofuran plays a significant role in both the pharmaceutical and biological research industries, acting as a versatile intermediate for the synthesis of compounds with potential therapeutic and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 93680-80-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,6,8 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 93680-80:
(7*9)+(6*3)+(5*6)+(4*8)+(3*0)+(2*8)+(1*0)=159
159 % 10 = 9
So 93680-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O3/c1-7(11)13-10-6-12-9-5-3-2-4-8(9)10/h2-6H,1H3
