937692-64-3 Usage
General Description
"(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid" is a chemical compound with the molecular formula C13H17NO4. It is a pyrrolidine derivative with a carboxylic acid functional group and a methoxyphenyl substituent. (3S,4R)-4-(3-METHOXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID is a chiral molecule with two stereocenters, designated as 3S and 4R. It may have potential applications in pharmaceutical research and development due to its unique structure and potential biological activities. The compound's specific chemical and physical properties, as well as its potential uses, may be explored further through scientific research and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 937692-64-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,7,6,9 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 937692-64:
(8*9)+(7*3)+(6*7)+(5*6)+(4*9)+(3*2)+(2*6)+(1*4)=223
223 % 10 = 3
So 937692-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c1-16-9-4-2-3-8(5-9)10-6-13-7-11(10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15)/t10-,11+/m0/s1
