93778-27-9 Usage
General Description
2,4-dihydro-5-undecyl-3H-pyrazol-3-one is a synthetic compound that belongs to the class of pyrazolones. It is a derivative of pyrazolone and is commonly used as an intermediate in the production of other chemicals and pharmaceuticals. It has a molecular formula of C15H27N3O and a molecular weight of 265.39 g/mol. 2,4-dihydro-5-undecyl-3H-pyrazol-3-one is known for its potential biological activities and is studied for its anti-inflammatory, analgesic, and anti-cancer properties. Additionally, it is used as a chelating agent and metal complexing agent in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 93778-27-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,7,7 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93778-27:
(7*9)+(6*3)+(5*7)+(4*7)+(3*8)+(2*2)+(1*7)=179
179 % 10 = 9
So 93778-27-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H26N2O/c1-2-3-4-5-6-7-8-9-10-11-13-12-14(17)16-15-13/h2-12H2,1H3,(H,16,17)
