93840-86-9 Usage
Type of compound
Ether an organic compound formed by the linkage of two alkyl or aryl groups through an oxygen atom.
Alkyl chain structure
Branched the carbon atoms in the compound are arranged in a branching pattern, rather than a straight chain.
Methoxy group
-OCH3 a functional group consisting of an oxygen atom connected to a methyl group (CH3), which is attached to the main alkyl chain.
Physical state
Colorless liquid a transparent, colorless liquid without the presence of any color.
Odor
Strong the compound has a noticeable and potent smell.
Stability
Relatively stable the compound remains relatively unchanged under normal conditions, without undergoing any significant chemical reactions.
Common use
Solvent 1-methoxy-3,7-dimethyloctane is frequently used as a solvent in various chemical reactions and processes to dissolve substances.
Toxicity
Low the compound is known for its low toxicity levels, making it safer for use in industrial and laboratory settings.
Safety
Relatively safe due to its low toxicity, 1-methoxy-3,7-dimethyloctane is considered to be a safer option for use in different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 93840-86-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,8,4 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 93840-86:
(7*9)+(6*3)+(5*8)+(4*4)+(3*0)+(2*8)+(1*6)=159
159 % 10 = 9
So 93840-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H24O/c1-10(2)6-5-7-11(3)8-9-12-4/h10-11H,5-9H2,1-4H3
