94022-57-8 Usage
Description
(Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide is a complex chemical compound characterized by a long hydrocarbon chain connected to a propionamide group. (Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide features a phenylmethyl and an aminomethyl group attached to the nitrogen atom, which may contribute to its potential biological activities and uses in various industries.
Uses
Used in Pharmaceutical Industry:
(Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide is used as a chemical intermediate for the development of new pharmaceutical products. Its unique structure and potential biological activities make it a promising candidate for further research and development in the pharmaceutical sector.
Used in Antiviral Applications:
In the field of antiviral research, (Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide is used as an active compound with potential antiviral properties. Its ability to interact with viral components and inhibit their replication could lead to the development of new antiviral drugs.
Used in Antibacterial Applications:
(Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide is also used as an active compound with potential antibacterial properties. Its structure and functional groups may enable it to target and inhibit bacterial growth, making it a valuable asset in the development of new antibiotics.
Additional research is necessary to fully understand the potential uses and effects of (Z)-N-[[3-(aminomethyl)phenyl]methyl]-3-(9-octadecenylamino)propionamide, as well as to optimize its application in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 94022-57-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,2 and 2 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 94022-57:
(7*9)+(6*4)+(5*0)+(4*2)+(3*2)+(2*5)+(1*7)=118
118 % 10 = 8
So 94022-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C29H51N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-31-23-21-29(33)32-26-28-20-18-19-27(24-28)25-30/h9-10,18-20,24,31H,2-8,11-17,21-23,25-26,30H2,1H3,(H,32,33)/b10-9-