94088-10-5 Usage
Description
(Z)-7,9,9-triethoxynon-3-ene is a chemical compound consisting of carbon, hydrogen, and oxygen atoms. It is an alkene with a carbon-carbon double bond and a cis configuration, denoted by the "Z" in its name, which means the two ethoxy groups are on the same side of the double bond. (Z)-7,9,9-triethoxynon-3-ene is widely utilized in organic synthesis and as a reagent in various chemical reactions due to its unique properties and reactivity.
Uses
Used in Organic Synthesis:
(Z)-7,9,9-triethoxynon-3-ene is used as a key intermediate in organic synthesis for the production of a variety of compounds. Its unique structure and reactivity make it a valuable building block for creating complex molecules.
Used in Fragrance Production:
(Z)-7,9,9-triethoxynon-3-ene is used as a base material in the fragrance industry for creating various scent compounds. Its chemical properties allow for the development of unique and long-lasting fragrances.
Used in Pharmaceutical Industry:
(Z)-7,9,9-triethoxynon-3-ene is used as a starting compound or a reagent in the synthesis of pharmaceuticals. Its versatility in chemical reactions enables the production of a wide range of medicinal compounds.
Used in Specialty Chemicals:
(Z)-7,9,9-triethoxynon-3-ene is employed in the production of specialty chemicals, such as additives, coatings, and polymers, due to its specific chemical properties and reactivity. Its applications in this industry contribute to the development of innovative materials with tailored properties.
Check Digit Verification of cas no
The CAS Registry Mumber 94088-10-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,8 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 94088-10:
(7*9)+(6*4)+(5*0)+(4*8)+(3*8)+(2*1)+(1*0)=145
145 % 10 = 5
So 94088-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H30O3/c1-5-9-10-11-12-14(16-6-2)13-15(17-7-3)18-8-4/h9-10,14-15H,5-8,11-13H2,1-4H3/b10-9+
