94108-37-9 Usage
Chemical class
Pyrrolidine carboxylic acids
Type of compound
Organic compound
Applications
Building block in the synthesis of pharmaceutical products, precursor in the production of fine chemicals, research and development in organic chemistry and drug discovery
Potential
Biological activities, interest in the field of medicinal chemistry
Versatility
Potential applications in various industries and scientific pursuits
Check Digit Verification of cas no
The CAS Registry Mumber 94108-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,0 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 94108-37:
(7*9)+(6*4)+(5*1)+(4*0)+(3*8)+(2*3)+(1*7)=129
129 % 10 = 9
So 94108-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H27NO3/c1-2-3-4-5-6-7-8-9-10-16-12-13(15(18)19)11-14(16)17/h13H,2-12H2,1H3,(H,18,19)
