94159-29-2 Usage
Description
(Z)-2-(3-hexenyloxy)-3-methylpyrazine is a chemical compound known for its unique aromatic properties. It is characterized by a pyrazine ring with a hexenyl side chain and a methyl group, which contribute to its earthy, nutty, and slightly smoky scent. (Z)-2-(3-hexenyloxy)-3-methylpyrazine is commonly found in various food products, including coffee, roasted nuts, and certain fruits and vegetables, and plays a significant role in the flavor and fragrance industry.
Uses
Used in Flavor and Fragrance Industry:
(Z)-2-(3-hexenyloxy)-3-methylpyrazine is used as a flavoring agent for its characteristic earthy, nutty, and slightly smoky aroma. It is particularly valued for its ability to enhance the taste and smell of food products, such as coffee and roasted nuts, as well as certain fruits and vegetables.
Used in the Food Industry:
In the food industry, (Z)-2-(3-hexenyloxy)-3-methylpyrazine is used as an additive to impart a desirable aroma to various products. Its presence contributes to the characteristic smell of grilled and charred foods, making it a popular choice for enhancing the sensory experience of these dishes.
Used in the Perfumery Industry:
(Z)-2-(3-hexenyloxy)-3-methylpyrazine is also utilized in the perfumery industry to create unique and complex fragrances. Its distinct scent can be used to add depth and richness to perfume compositions, making it a valuable component in the creation of long-lasting and memorable scents.
Check Digit Verification of cas no
The CAS Registry Mumber 94159-29-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,5 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 94159-29:
(7*9)+(6*4)+(5*1)+(4*5)+(3*9)+(2*2)+(1*9)=152
152 % 10 = 2
So 94159-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O/c1-3-4-5-6-9-14-11-10(2)12-7-8-13-11/h4-5,7-8H,3,6,9H2,1-2H3/b5-4+
