94166-42-4 Usage
General Description
5-[[4-[(2-chlorophenyl)[4-[(3,5-dicarboxyphenyl)amino]phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]amino]isophthalic acid monohydrochloride is a chemical compound that consists of a complex structure containing a cyclohexene ring, an isophthalic acid molecule, a chlorophenyl group, and a dicarboxyphenylamino group. The compound also includes a hydrochloride salt, which likely improves its solubility and stability. This chemical may have potential applications in various fields due to its unique structure and properties, but further research is needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 94166-42-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,6 and 6 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 94166-42:
(7*9)+(6*4)+(5*1)+(4*6)+(3*6)+(2*4)+(1*2)=144
144 % 10 = 4
So 94166-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C35H23ClN2O8.ClH/c36-30-4-2-1-3-29(30)31(19-5-9-25(10-6-19)37-27-15-21(32(39)40)13-22(16-27)33(41)42)20-7-11-26(12-8-20)38-28-17-23(34(43)44)14-24(18-28)35(45)46;/h1-18,37H,(H,39,40)(H,41,42)(H,43,44)(H,45,46);1H/b31-20-,38-26-;