943522-94-9 Usage
Description
2-(Aminocarbonyl)-3-nitrobenzoic Acid Potassium Salt is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its unique structure, which includes an aminocarbonyl group and a nitrobenzoic acid moiety, attached to a potassium salt. 2-(Aminocarbonyl)-3-nitrobenzoic Acid Potassium Salt plays a significant role in the development of new drugs and materials due to its versatile chemical properties.
Uses
Used in Pharmaceutical Industry:
2-(Aminocarbonyl)-3-nitrobenzoic Acid Potassium Salt is used as a key intermediate in the synthesis of a benzimidazole PARP (Poly ADP-ribose polymerase) inhibitor I (succinate salt), also known as ABT-472. This PARP inhibitor is a promising therapeutic agent for the treatment of various types of cancer, as it can effectively inhibit the activity of PARP enzymes, leading to the induction of cell death in cancer cells.
As a crucial component in the synthesis of ABT-472, 2-(Aminocarbonyl)-3-nitrobenzoic Acid Potassium Salt contributes to the development of innovative cancer treatments that can potentially improve patient outcomes and offer new therapeutic options for those suffering from various malignancies. Its role in the pharmaceutical industry highlights the importance of this compound in advancing medical research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 943522-94-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,3,5,2 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 943522-94:
(8*9)+(7*4)+(6*3)+(5*5)+(4*2)+(3*2)+(2*9)+(1*4)=179
179 % 10 = 9
So 943522-94-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O5.K/c9-7(11)6-4(8(12)13)2-1-3-5(6)10(14)15;/h1-3H,(H2,9,11)(H,12,13);/q;+1/p-1
