944899-22-3 Usage
General Description
7-(benzyloxy)-3-iodo-1H-indazole is a chemical compound with the molecular formula C14H11IN2O. It is a derivative of indazole, a heterocyclic compound containing a five-membered ring with two nitrogen atoms. The presence of the benzyl ether group and the iodine atom in the molecule gives it unique chemical properties and potential applications in various fields such as pharmaceuticals, agrochemicals, and materials science. Its precise uses and effects would need to be determined through further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 944899-22-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,8,9 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 944899-22:
(8*9)+(7*4)+(6*4)+(5*8)+(4*9)+(3*9)+(2*2)+(1*2)=233
233 % 10 = 3
So 944899-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H11IN2O/c15-14-11-7-4-8-12(13(11)16-17-14)18-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,16,17)
