944900-87-2 Usage
General Description
3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine is a chemical compound with the molecular formula C7H9BrN2. It is a heterocyclic compound containing a bromine atom and a pyrazine ring. This chemical has shown potential for use as a building block in the synthesis of various pharmaceutical and agrochemical products. It has also been studied for its potential biological activities, including as an antiviral and antibacterial agent. Its unique structure and properties make it a valuable compound for further research and development in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 944900-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 944900-87:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*0)+(2*8)+(1*7)=192
192 % 10 = 2
So 944900-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrN3/c7-6-9-4-5-3-8-1-2-10(5)6/h4,8H,1-3H2