944902-03-8 Usage
General Description
4-chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-d]pyrimidine is a chemical compound with the molecular formula C9H10ClN3S. It is a heterocyclic compound that contains a chlorine atom and a methylthio group. 4-chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-d]pyrimidine has potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block for the synthesis of various biologically active molecules. It may also have potential uses in the field of medicinal chemistry and drug discovery. Furthermore, its unique structure and properties make it a target for further research and development in the field of organic synthesis and chemical biology.
Check Digit Verification of cas no
The CAS Registry Mumber 944902-03-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 944902-03:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*2)+(2*0)+(1*3)=178
178 % 10 = 8
So 944902-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN3S/c1-13-8-11-6-2-3-10-4-5(6)7(9)12-8/h10H,2-4H2,1H3