944937-79-5 Usage
Description
1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile is an organic compound with a unique heterocyclic structure, featuring a pyrrolo-pyridine core and a carbonitrile functional group. 1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile serves as a key intermediate in the synthesis of various biologically active molecules, particularly in the development of pharmaceuticals targeting specific kinases.
Uses
Used in Pharmaceutical Industry:
1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile is used as a synthetic intermediate for the development of N-substituted azaindoles as Cdc7 kinase inhibitors. These inhibitors have potential applications in the treatment of various diseases, including cancer, by targeting the Cdc7 kinase enzyme, which plays a crucial role in the regulation of cell cycle progression and DNA replication.
Additionally, the compound 1-(1H-Pyrrolo[3,2-b]pyridin-6-yl)cyclopropanamine, derived from 1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile, also shows potential in the synthesis of N-substituted azaindoles as Cdc7 kinase inhibitors. This highlights the versatility and importance of 1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile in the design and synthesis of novel therapeutic agents for the treatment of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 944937-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,3 and 7 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 944937-79:
(8*9)+(7*4)+(6*4)+(5*9)+(4*3)+(3*7)+(2*7)+(1*9)=225
225 % 10 = 5
So 944937-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5N3/c9-4-6-3-8-7(11-5-6)1-2-10-8/h1-3,5,10H