946843-80-7 Usage
Description
Cupric tartrate hydrate is a copper-containing coordination compound that forms blue crystals. It is soluble in water and has the chemical formula C6H4O8Cu.3H2O.
Uses
Used in Polymerization Industry:
Cupric tartrate hydrate is used as a catalyst for the fabrication of helical polyacetylene fibers by the polymerization of acetylene. Its catalytic activity enables the formation of chiral polymers with unique properties and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 946843-80-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,6,8,4 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 946843-80:
(8*9)+(7*4)+(6*6)+(5*8)+(4*4)+(3*3)+(2*8)+(1*0)=217
217 % 10 = 7
So 946843-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O6.Cu.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+2;/p-2