94825-74-8 Usage
Description
2-ACETAMIDO-2-DEOXY-3-O-METHYL-D-GLUCOPYRANOSE is a chemical compound that acts as an inhibitor of N-Acetylglucosamine kinase in the glucose metabolism pathway. It is an off-white solid with unique chemical properties that make it suitable for various applications.
Uses
Used in Pharmaceutical Industry:
2-ACETAMIDO-2-DEOXY-3-O-METHYL-D-GLUCOPYRANOSE is used as a pharmaceutical agent for its inhibitory effect on N-Acetylglucosamine kinase, which plays a crucial role in the glucose metabolism pathway. This inhibition can have potential therapeutic applications in the treatment of certain diseases and conditions related to glucose metabolism.
Used in Research and Development:
2-ACETAMIDO-2-DEOXY-3-O-METHYL-D-GLUCOPYRANOSE is used as a research compound for studying the role of N-Acetylglucosamine kinase in glucose metabolism and its potential as a target for drug development. Its off-white solid form makes it suitable for various experimental procedures and analyses.
Used in Chemical Synthesis:
2-ACETAMIDO-2-DEOXY-3-O-METHYL-D-GLUCOPYRANOSE can be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, or materials science. Its unique chemical properties allow for further modification and functionalization to create new molecules with desired properties.
Check Digit Verification of cas no
The CAS Registry Mumber 94825-74-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,8,2 and 5 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 94825-74:
(7*9)+(6*4)+(5*8)+(4*2)+(3*5)+(2*7)+(1*4)=168
168 % 10 = 8
So 94825-74-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H17NO6/c1-4(12)10-6-8(15-2)7(13)5(3-11)16-9(6)14/h5-9,11,13-14H,3H2,1-2H3,(H,10,12)/t5?,6-,7+,8+,9+/m0/s1