948292-29-3 Usage
General Description
4,5-Dichloro-8-methylquinoline is a synthetic chemical compound with a molecular formula C11H8Cl2N. It is a derivative of quinoline and is characterized by the presence of two chlorine atoms at the 4th and 5th positions and a methyl group at the 8th position on the quinoline ring. 4,5-Dichloro-8-methylquinoline is commonly used in the synthesis of pharmaceutical drugs and agrochemicals due to its unique chemical properties. It is also being investigated for its potential biological activities, including its antimicrobial and antitumor effects. However, further research is needed to fully understand the potential applications and risks associated with 4,5-Dichloro-8-methylquinoline.
Check Digit Verification of cas no
The CAS Registry Mumber 948292-29-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,8,2,9 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 948292-29:
(8*9)+(7*4)+(6*8)+(5*2)+(4*9)+(3*2)+(2*2)+(1*9)=213
213 % 10 = 3
So 948292-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7Cl2N/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-5H,1H3
