94861-76-4 Usage
General Description
Diethyl 2-(3,5-diiodo-4-(4-Methoxyphenoxy)benzyl)Malonate is a chemical compound with a complex structure that includes two ethyl groups, a benzene ring, and a malonic acid derivative. It also contains two iodine atoms and a methoxy group attached to the benzene ring. Diethyl 2-(3,5-diiodo-4-(4-Methoxyphenoxy)benzyl)Malonate is used in scientific research and pharmaceutical development, particularly in the study of organic chemistry and medicinal applications. Its specific properties and potential uses may vary depending on the context of the research or production process in which it is being utilized.
Check Digit Verification of cas no
The CAS Registry Mumber 94861-76-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,8,6 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 94861-76:
(7*9)+(6*4)+(5*8)+(4*6)+(3*1)+(2*7)+(1*6)=174
174 % 10 = 4
So 94861-76-4 is a valid CAS Registry Number.
InChI:InChI=1S/C21H22I2O6/c1-4-27-20(24)16(21(25)28-5-2)10-13-11-17(22)19(18(23)12-13)29-15-8-6-14(26-3)7-9-15/h6-9,11-12,16H,4-5,10H2,1-3H3