952182-19-3 Usage
General Description
Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a chemical compound that often appears as a reagent in various chemical reactions. Its molecular formula is C9H7ClN2O2. methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a derivative of the pyrrolo[2,3-b]pyridine class of organic compounds, characterized by a pyrrolopyridine core, which is essentially a pyrrole fused with a pyridine ring structure. Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate often plays a role in medicinal chemistry and chemical research due to its reactivity. However, there is limited information on its specific uses and properties, which may be due to its specialized or emerging applications in precise chemical synthesis and research fields.
Check Digit Verification of cas no
The CAS Registry Mumber 952182-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,2,1,8 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 952182-19:
(8*9)+(7*5)+(6*2)+(5*1)+(4*8)+(3*2)+(2*1)+(1*9)=173
173 % 10 = 3
So 952182-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c1-14-9(13)7-3-5-2-6(10)4-11-8(5)12-7/h2-4H,1H3,(H,11,12)
