954239-19-1 Usage
General Description
3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride is a chemical compound used in scientific and laboratory work, particularly in the area of pharmacology. Being a brominated compound, it carries specific properties such as high reactivity and is noted for its use in chemical synthesis. 3-BROMO-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRAZINEHYDROCHLORIDE is part of the tetrahydroimidazopyrazine family, known for their broad-spectrum applications ranging from anticancer to antimicrobial potential. It also carries a hydrochloride group which often lends these molecules increased solubility in water and higher stability, making it easier to handle and store. It is noteworthy that safety measures should be adopted while handling this compound due to its reactivity and potential hazardous effects.
Check Digit Verification of cas no
The CAS Registry Mumber 954239-19-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,4,2,3 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 954239-19:
(8*9)+(7*5)+(6*4)+(5*2)+(4*3)+(3*9)+(2*1)+(1*9)=191
191 % 10 = 1
So 954239-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrN3.ClH/c7-5-3-9-6-4-8-1-2-10(5)6;/h3,8H,1-2,4H2;1H