95470-68-1 Usage
General Description
(4-Isopropyl-piperazin-1-yl)-acetic acid is a chemical compound that falls under the category of piperazines. Piperazines are a class of organic compounds that contain a six-membered ring and two nitrogen atoms at opposite positions in the ring. The presence of the isopropyl group at the 4th position in this specific compound indicates that it may exhibit unique interactions and properties compared to other piperazine compounds. Acetic acid is attached to the piperazine ring, which may result in the compound having acidic properties. The exact properties, uses, and potential hazards of this specific compound may vary and would likely be determined through specific scientific evaluation and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 95470-68-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,4,7 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 95470-68:
(7*9)+(6*5)+(5*4)+(4*7)+(3*0)+(2*6)+(1*8)=161
161 % 10 = 1
So 95470-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O2/c1-8(2)11-5-3-10(4-6-11)7-9(12)13/h8H,3-7H2,1-2H3,(H,12,13)
95470-68-1Relevant articles and documents
BENZOFURAN DERIVATIVE
-
Page 190, (2008/06/13)
The present invention provides a benzofuran derivative of the formula [1]: wherein x is a group of the formula: -N="or" -CH=; Y is an optionally substituted amino group, an optionally substituted cycloalkyl group or an optionally substituted saturated heterocyclic group; A is a single bond, a carbon chain optionally having a double bond within or at the end(s) of the chain, or an oxygen atom; R1 is a hydrogen atom or a halogen atom; Ring B is an optionally substituted benzene ring; and R3 is a hydrogen atom, or a pharmaceutically acceptable salt thereof, which is useful as a medicament, especially as an activated blood coagulation factor X inhibitor.
