95695-47-9 Usage
Description
N-(2,4-Dichlorophenyl)maleamic acid, a white crystalline compound with the molecular formula C8H6Cl2NO3, is a maleic acid derivative featuring two chlorine atoms attached to the phenyl group. It is utilized in organic synthesis, chemical research, and serves as a building block for synthesizing various compounds. N-(2,4-DICHLOROPHENYL)MALEAMIC ACID also holds potential in pharmaceuticals, agrochemicals, and materials science, with ongoing studies exploring its biological and pharmacological activities.
Uses
Used in Pharmaceutical Industry:
N-(2,4-Dichlorophenyl)maleamic acid is used as an intermediate in the synthesis of pharmaceutical compounds due to its unique chemical structure and reactivity, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, N-(2,4-Dichlorophenyl)maleamic acid is employed as a precursor for the development of agrochemical products, such as pesticides and herbicides, leveraging its chemical properties to enhance crop protection and yield.
Used in Materials Science:
N-(2,4-Dichlorophenyl)maleamic acid is utilized as a component in the creation of advanced materials, taking advantage of its structural attributes to engineer materials with specific properties for various applications in science and industry.
Used in Chemical Research:
As a building block in chemical research, N-(2,4-Dichlorophenyl)maleamic acid aids in the exploration and understanding of chemical reactions and mechanisms, furthering scientific knowledge and potentially leading to innovative discoveries.
Used in Organic Synthesis:
N-(2,4-Dichlorophenyl)maleamic acid is used as a reactant in organic synthesis processes, enabling the production of a wide range of organic compounds for diverse applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 95695-47-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,6,9 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 95695-47:
(7*9)+(6*5)+(5*6)+(4*9)+(3*5)+(2*4)+(1*7)=189
189 % 10 = 9
So 95695-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H7Cl2NO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3-
