957065-91-7 Usage
General Description
6-Chloro-N,N-dipropylpyrazin-2-amine is a chemical compound that belongs to the class of amines. It is characterized by the presence of a chloro group and two propyl groups attached to a pyrazine ring. 6-Chloro-N,N-dipropylpyrazin-2-amine is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs and pharmaceutical compounds. Its chemical properties and structure make it suitable for specific reactions and transformations, making it a valuable building block in organic synthesis. Additionally, its properties and potential biological activities make it a subject of research in medicinal chemistry for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 957065-91-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 957065-91:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*5)+(2*9)+(1*1)=207
207 % 10 = 7
So 957065-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H16ClN3/c1-3-5-14(6-4-2)10-8-12-7-9(11)13-10/h7-8H,3-6H2,1-2H3
