95837-21-1 Usage
General Description
1-Fluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is a highly complex chemical compound with multiple organic structures. It contains a fluoro group, a benzene ring, and multiple cyclohexyl rings, arranged in a unique configuration. The compound also features an ethyl group and a substituted ethylcyclohexyl group, adding to its complexity. Due to its intricate structure, the chemical may have potential applications in pharmaceuticals, materials science, or organic synthesis. Its specific properties and potential uses would likely require further study and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 95837-21-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,8,3 and 7 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 95837-21:
(7*9)+(6*5)+(5*8)+(4*3)+(3*7)+(2*2)+(1*1)=171
171 % 10 = 1
So 95837-21-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H33F/c1-2-17-3-5-18(6-4-17)7-8-19-9-11-20(12-10-19)21-13-15-22(23)16-14-21/h13-20H,2-12H2,1H3