96219-78-2 Usage
Chemical structure
A complex structure containing carbon, hydrogen, nitrogen, and oxygen.
Nitrile compound
A compound that contains a nitrile group (C≡N) and may be used in the synthesis of various pharmaceutical drugs or other organic compounds.
Dimethylamino group
A functional group (N(CH3)2) present in the compound, contributing to its unique properties and potential applications.
Methylenedioxyphenyl group
A functional group (C6H4(OCH2)2) present in the compound, contributing to its unique properties and potential applications.
3-Oxo
The compound contains a 3-keto group (C=O), indicating the presence of an oxygen atom double-bonded to a carbon atom in the third position of the molecule.
Propanenitrile
The compound is derived from a propanenitrile structure, which is a three-carbon nitrile compound.
Synthesis interest
Due to its complex structure and the presence of multiple functional groups, its synthesis and chemical properties may be of interest to researchers in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 96219-78-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,2,1 and 9 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 96219-78:
(7*9)+(6*6)+(5*2)+(4*1)+(3*9)+(2*7)+(1*8)=162
162 % 10 = 2
So 96219-78-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O3/c1-15(2)7-10(6-14)13(16)9-3-4-11-12(5-9)18-8-17-11/h3-5,7H,8H2,1-2H3/b10-7+
