966-06-3 Usage
Description
(8R,9S,13S,14S)-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16 octahydro-6H-cyclopenta[a]phenanthren-17-one is a 3-hydroxy steroid that is estrone substituted by a beta-hydroxy group at position 16. It is a complex organic compound with a unique molecular structure.
Uses
Used in Pharmaceutical Industry:
(8R,9S,13S,14S)-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16 octahydro-6H-cyclopenta[a]phenanthren-17-one is used as a pharmaceutical agent for its potential therapeutic effects. Its unique molecular structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Drug Delivery Systems:
(8R,9S,13S,14S)-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16 octahydro-6H-cyclopenta[a]phenanthren-17-one can be used in drug delivery systems to improve the bioavailability and therapeutic efficacy of other drugs. Its unique properties may allow for targeted delivery and controlled release of pharmaceutical agents, enhancing their effectiveness and reducing side effects.
Used in Chemical Research:
(8R,9S,13S,14S)-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16 octahydro-6H-cyclopenta[a]phenanthren-17-one is also used in chemical research for its unique molecular structure and potential applications in the development of new compounds and materials. Its synthesis and modification can provide valuable insights into the properties and behavior of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 966-06-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,6 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 966-06:
(5*9)+(4*6)+(3*6)+(2*0)+(1*6)=93
93 % 10 = 3
So 966-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H22O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-16,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,18+/m1/s1
966-06-3Relevant articles and documents
Alternative synthesis for the preparation of 16α-[ 18F]fluoroestradiol
Kil, Hee Seup,Cho, Han Yang,Lee, Sang Ju,Oh, Seung Jun,Chi, Dae Yoon
, p. 619 - 626 (2013/12/04)
We have developed a new precursor, 3,17β-O-bis(methoxymethyl)- 16β-O-p-nitrobenzenesulfonylestriol (14c) of 16α-[ 18F]fluoroestradiol ([18F]FES). Although we could not selectively protect the C17 alcohol in the presence of the C16 al
