989-77-5 Usage
Molecular structure
1-ethyl-2-[3-(1-ethylnaphtho[1,2-d]thiazolin-2-ylidene)-2-methylpropenyl]naphtho[1,2-d]thiazolium chloride has a complex molecular structure that includes a naphtho[1,2-d]thiazolium core and a thiazoline ring.
Functional groups
The compound contains multiple ethyl (C2H5) and methyl (CH3) groups, which are alkyl groups that can influence its chemical reactivity and physical properties.
Thiazoline ring
A heterocyclic ring structure containing sulfur and nitrogen atoms, which can contribute to the compound's chemical properties and potential applications.
Potential applications
Due to its complex structure and specific properties, 1-ethyl-2-[3-(1-ethylnaphtho[1,2-d]thiazolin-2-ylidene)-2-methylpropenyl]naphtho[1,2-d]thiazolium chloride may have uses in various industries, such as an organic dye or a catalyst in chemical reactions.
Handling and storage
The compound's complex structure and specific properties may require careful handling and storage to maintain its stability and prevent unwanted reactions or degradation.
Check Digit Verification of cas no
The CAS Registry Mumber 989-77-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,8 and 9 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 989-77:
(5*9)+(4*8)+(3*9)+(2*7)+(1*7)=125
125 % 10 = 5
So 989-77-5 is a valid CAS Registry Number.
InChI:InChI=1/C30H27N2S2.ClH/c1-4-31-27(33-25-16-14-21-10-6-8-12-23(21)29(25)31)18-20(3)19-28-32(5-2)30-24-13-9-7-11-22(24)15-17-26(30)34-28;/h6-19H,4-5H2,1-3H3;1H/q+1;/p-1