99217-63-7 Usage
Description
Leachianone E is a natural compound derived from the plant Leachia spiralis, which is known for its unique chemical structure and potential biological activities. It possesses various functional groups that enable it to interact with different biological targets, making it a promising candidate for various applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
Leachianone E is used as a non-competitive tyrosinase inhibitor for its ability to block the conversion of L-tyrosine to L-DOPA. This property makes it a potential candidate for the treatment of melanoma and other skin-related disorders.
Leachianone E is also used as a flavonoid antioxidant with inhibitory effects on alpha-glucosidase and β-amylase. Its antioxidant properties can help protect cells from oxidative stress and damage, while its inhibitory effects on these enzymes can be beneficial in managing diabetes and related metabolic disorders.
Used in Chemical Industry:
Leachianone E can be used as a starting material or intermediate in the synthesis of various chemical compounds and pharmaceuticals. Its unique structure and functional groups make it a valuable building block for the development of new drugs and other chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 99217-63-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,2,1 and 7 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 99217-63:
(7*9)+(6*9)+(5*2)+(4*1)+(3*7)+(2*6)+(1*3)=167
167 % 10 = 7
So 99217-63-7 is a valid CAS Registry Number.
InChI:InChI=1/C25H28O5/c1-14(2)9-10-16(15(3)4)11-18-20(27)12-21(28)24-22(29)13-23(30-25(18)24)17-7-5-6-8-19(17)26/h5-9,12,16,23,26-28H,3,10-11,13H2,1-2,4H3/t16?,23-/m0/s1