99717-87-0 Usage
Description
4-Vinylbenzocyclobutene is a chemical compound characterized by its liquid state and unique chemical properties. It is known for its ability to form crosslinks, which is a key feature in enhancing the mechanical properties of certain materials.
Uses
Used in Advanced Material Industry:
4-Vinylbenzocyclobutene is used as a crosslinking agent for improving the mechanical properties of carbon nanotube fibers. Its application in this industry is crucial for the development of stronger and more durable materials, which can be utilized in various applications such as aerospace, automotive, and electronics.
Used in Chemical Research:
4-Vinylbenzocyclobutene is also used as a reagent in chemical research, where its unique properties can be explored and harnessed for the development of new compounds and materials. Its liquid state and crosslinking ability make it a valuable component in the synthesis of novel polymers and other advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 99717-87-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,7,1 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 99717-87:
(7*9)+(6*9)+(5*7)+(4*1)+(3*7)+(2*8)+(1*7)=200
200 % 10 = 0
So 99717-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10/c1-2-8-3-4-9-5-6-10(9)7-8/h2-4,7H,1,5-6H2