99764-53-1 Usage
General Description
The chemical "(3S,6S,9R,12S)-6-(4-aminobutyl)-12-benzyl-9-butan-2-yl-3-[(4-hydroxyph enyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexon e" is a complex organic compound with a large molecular structure containing a variety of functional groups. It includes amines, benzyl groups, butyl groups, and a hydroxyphenyl group, all arranged in a cyclic arrangement. (3S,6S,9R,12S)-6-(4-aminobutyl)-12-benzyl-9-butan-2-yl-3-[(4-hydroxyph enyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexon e has a large molecular weight, and it likely has a high degree of molecular complexity and potential for specific biological activity or chemical reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 99764-53-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,7,6 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 99764-53:
(7*9)+(6*9)+(5*7)+(4*6)+(3*4)+(2*5)+(1*3)=201
201 % 10 = 1
So 99764-53-1 is a valid CAS Registry Number.
InChI:InChI=1/C34H47N7O7/c1-3-21(2)30-34(48)39-25(11-7-8-16-35)32(46)40-26(18-23-12-14-24(42)15-13-23)31(45)37-19-28(43)36-20-29(44)38-27(33(47)41-30)17-22-9-5-4-6-10-22/h4-6,9-10,12-15,21,25-27,30,42H,3,7-8,11,16-20,35H2,1-2H3,(H,36,43)(H,37,45)(H,38,44)(H,39,48)(H,40,46)(H,41,47)/t21?,25-,26-,27-,30+/m0/s1