112596-36-8 Usage
Description
1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE is an organic compound characterized by its unique molecular structure, which features a pyrrole ring attached to a bromomethylphenyl group. 1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE is known for its potential applications in various fields, particularly in the pharmaceutical and chemical industries, due to its versatile chemical properties.
Uses
Used in Pharmaceutical Industry:
1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE is used as an intermediate in the preparation of Iminoribitol derivatives. These derivatives serve as inhibitors of a purine-specific nucleoside hydrolase, which plays a crucial role in the regulation of purine metabolism. By inhibiting this enzyme, Iminoribitol derivatives can potentially be used in the treatment of various diseases associated with purine metabolism disorders.
Additionally, due to its unique chemical structure, 1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE may also be utilized in the synthesis of other pharmaceutical compounds, potentially leading to the development of new drugs with diverse therapeutic applications.
Used in Chemical Industry:
In the chemical industry, 1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE can be employed as a building block for the synthesis of various organic compounds. Its bromomethylphenyl group can be further functionalized or modified to create a wide range of products with different properties and applications. This versatility makes it a valuable compound for the development of new materials and chemicals with potential uses in various industries, such as plastics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 112596-36-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,5,9 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 112596-36:
(8*1)+(7*1)+(6*2)+(5*5)+(4*9)+(3*6)+(2*3)+(1*6)=118
118 % 10 = 8
So 112596-36-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9H2
112596-36-8Relevant articles and documents
Discovery of novel pyrrole-based scaffold as potent and orally bioavailable free fatty acid receptor 1 agonists for the treatment of type 2 diabetes
Li, Zheng,Pan, Miaobo,Su, Xin,Dai, Yuxuan,Fu, Mian,Cai, Xingguang,Shi, Wei,Huang, Wenlong,Qian, Hai
, p. 1981 - 1987 (2016)
The free fatty acid receptor 1 (FFA1) has gained significant interest as a novel antidiabetic target. Most of FFA1 agonists reported in the literature bearing a common biphenyl scaffold, which was crucial for toxicity verified by the researchers of Daiichi Sankyo. Herein, we describe the systematic exploration of non-biphenyl scaffold and further chemical modification of the optimal pyrrole scaffold. All of these efforts led to the identification of compound 11 as a potent and orally bioavailable FFA1 agonist without the risk of hypoglycemia. Further molecular modeling studies promoted the understanding of ligand-binding pocket and might help to design more promising FFA1 agonists.
Inhibition of Copper-Dependent Amine Oxidases by Some Hydrazides of Pyrrol-1-ylbenzoic and Pyrrol-1-ylphenylacetic Acids
Artico, Marino,Corelli, Federico,Massa, Silvio,Stefancich, Giorgio,Avigliano, Luciana,et al.
, p. 802 - 806 (2007/10/02)
Some hydrazides of pyrrol-1-ylbenzoic and pyrrol-1-ylphenylacetic acids were prepared, and their effect on copper-dependent amine oxidases (Cu-AOs) and FAD monoamine oxidases (MAOs) activities was tested.The compounds were not substrates for Cu-AO enzymes
