168080-49-7 Usage
General Description
The compound, 2-chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid is an organic compound which falls under the category of benzamides. 2-chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid has three constituents in its molecular structure including a benzamide group, a carboxylic acid group and halogens. These functional groups can influence the chemical behaviour and reactivity of the compound. The chloro and fluoro groups represent the halogens, which are known for their electronegativity while the carboxylic acid group consists of a carbonyl (C=O) and a hydroxyl (OH) group that makes this compound an acid. The compound also contains a benzamido group, which is a type of amide where the nitrogen is bonded to a benzene ring. The presence of these different functional groups make this compound potentially usable for a range of synthesis reactions or in the development of pharmaceutical drugs. The specific properties, safety data, physiological effects and potential applications of this compound are subject to further research.
Check Digit Verification of cas no
The CAS Registry Mumber 168080-49-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,8,0,8 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 168080-49:
(8*1)+(7*6)+(6*8)+(5*0)+(4*8)+(3*0)+(2*4)+(1*9)=147
147 % 10 = 7
So 168080-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClFNO3/c1-8-2-3-9(17)6-12(8)14(19)18-10-4-5-11(15(20)21)13(16)7-10/h2-7H,1H3,(H,18,19)(H,20,21)