20485-43-2 Usage
Description
1-Methyl-1H-imidazole-2-carboxylic acid is an organic compound characterized as a white crystalline solid. It is a synthetic intermediate that plays a significant role in the creation of polyamides containing imidazole.
Uses
Used in Chemical Synthesis:
1-Methyl-1H-imidazole-2-carboxylic acid is used as a synthetic intermediate for the solid phase synthesis of polyamides containing imidazole. Its unique chemical structure allows for the formation of various complex molecules with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-Methyl-1H-imidazole-2-carboxylic acid is used as a building block for the development of novel drug candidates. Its ability to form polyamides with imidazole-containing structures makes it a valuable component in the design of new medications with potential therapeutic benefits.
Used in Material Science:
1-Methyl-1H-imidazole-2-carboxylic acid can also be utilized in the field of material science, where it may contribute to the development of advanced materials with specific properties. The imidazole-containing polyamides synthesized using this compound could have applications in areas such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 20485-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,4,8 and 5 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 20485-43:
(7*2)+(6*0)+(5*4)+(4*8)+(3*5)+(2*4)+(1*3)=92
92 % 10 = 2
So 20485-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2/c1-7-3-2-6-4(7)5(8)9/h2-3H,1H3,(H,8,9)/p-1
