2164-61-6 Usage
Description
3-Pyridazinecarboxylic acid, also known as the pyridazine analog of Nicotinic Acid, is an organic compound with the chemical formula C5H4N2O2. It possesses a unique structure that allows it to interact with specific biological systems, making it a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
3-Pyridazinecarboxylic acid is used as an antimicrobial agent for inhibiting the growth of Lactobacillus arabinosus, a bacteria commonly found in the human gastrointestinal tract. Its competitive inhibition mechanism makes it a valuable compound in the development of new drugs and therapies targeting bacterial infections.
Used in Research and Development:
3-Pyridazinecarboxylic acid serves as a key compound in the study of pyridazine-based analogs and their potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science. Its unique structure and properties make it an important tool for researchers in the synthesis and evaluation of new compounds with specific biological activities.
Used in Chemical Synthesis:
3-Pyridazinecarboxylic acid can be used as a building block or intermediate in the synthesis of more complex organic compounds, such as pharmaceuticals, agrochemicals, and other specialty chemicals. Its versatile structure allows for further functionalization and modification, enabling the development of novel compounds with improved properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2164-61-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,6 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2164-61:
(6*2)+(5*1)+(4*6)+(3*4)+(2*6)+(1*1)=66
66 % 10 = 6
So 2164-61-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O2/c8-5(9)4-2-1-3-6-7-4/h1-3H,(H,8,9)
