22620-27-5 Usage
Description
5-Chloronicotinic acid, also known as 5-chloro-3-pyridinecarboxylic acid, is an organic compound with the chemical formula C6H4ClNO2. It is an off-white powder and is used as a reagent and reactant in various chemical processes. Its unique chemical structure allows it to be involved in the synthesis of different compounds, particularly in the preparation of metal-organic frameworks (MOFs).
Uses
Used in Chemical Synthesis:
5-Chloronicotinic acid is used as a reagent and reactant in the synthesis of various compounds, particularly in the preparation of metal-organic frameworks (MOFs). Its chemical properties make it a versatile building block for creating complex structures with specific properties.
Used in Luminescence Applications:
5-Chloronicotinic acid is used as a component in the development of luminescent materials. Its incorporation into these materials can enhance their light-emitting properties, making them suitable for various applications, such as in lighting, displays, and sensors.
Used in Hydrothermal Preparation:
5-Chloronicotinic acid is employed in the hydrothermal preparation of cobalt/cadmium/lead chloronicotinate phenanthroline MOFs. These MOFs have potential applications in gas storage, catalysis, and drug delivery due to their unique structural and chemical properties.
Used in Pharmaceutical Industry:
5-Chloronicotinic acid can be used as a building block for the synthesis of various pharmaceutical compounds. Its reactivity and versatility make it a valuable component in the development of new drugs with specific therapeutic properties.
Used in Research and Development:
Due to its unique chemical properties and potential applications, 5-Chloronicotinic acid is also used in research and development for the creation of new materials and compounds with specific properties and applications in various industries, including electronics, energy, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 22620-27-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,2 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 22620-27:
(7*2)+(6*2)+(5*6)+(4*2)+(3*0)+(2*2)+(1*7)=75
75 % 10 = 5
So 22620-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10)
22620-27-5Relevant articles and documents
PYRROLOPYRIDAZINE DERIVATIVES
-
Page 253, (2008/06/13)
The invention relates to compound of the formula (I) or its salt, in which R1, R2, R3 and R4 are as defined in the description, their use of as medicament, the process for their preparation and use for the treatment of PDE-IV or TNF-α mediated diseases.
