31295-54-2 Usage
Description
N-(2-aminoethyl)piperazine-1,4-diethylamine, also known as 2-(4-2-[(2-aminoethyl)amino]ethylpiperazin-1-yl)ethan-1-amine, is an organic compound that serves as a precursor for the synthesis of lipid C12-200. N-(2-aminoethyl)piperazine-1,4-diethylamine is characterized by its reactive amino groups, which can interact with carboxylic acids, activated NHS esters, and carbonyls such as ketones and aldehydes.
Uses
Used in Pharmaceutical Industry:
N-(2-aminoethyl)piperazine-1,4-diethylamine is used as a precursor for the synthesis of lipid C12-200, which is a crucial component in the preparation of lipid-like materials. These materials are employed in the development of low-dose, in vivo gene silencing therapies. N-(2-aminoethyl)piperazine-1,4-diethylamine's reactivity with various functional groups allows for the creation of versatile and effective drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 31295-54-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,2,9 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 31295-54:
(7*3)+(6*1)+(5*2)+(4*9)+(3*5)+(2*5)+(1*4)=102
102 % 10 = 2
So 31295-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H25N5/c11-1-3-13-4-6-15-9-7-14(5-2-12)8-10-15/h13H,1-12H2