328000-16-4 Usage
Description
2-Benzyloxyphenylmagnesium bromide, 1M solution, is an organomagnesium compound that serves as a versatile reagent in various organic synthesis processes. It is characterized by its ability to participate in cross-coupling reactions and is particularly useful in the synthesis of complex organic molecules.
Uses
Used in Pharmaceutical Industry:
2-Benzyloxyphenylmagnesium bromide, 1M solution, is used as a synthetic reagent for the preparation of complex organic molecules, particularly in the context of pharmaceutical compounds. Its application in this industry is due to its ability to facilitate the formation of new carbon-carbon bonds, which are essential in the synthesis of various drug molecules.
Used in Chemical Research:
In the field of chemical research, 2-Benzyloxyphenylmagnesium bromide, 1M solution, is used as a key reagent in the development of new synthetic methods and the exploration of novel chemical reactions. Its application in this area is driven by its potential to enhance the understanding of organomagnesium chemistry and contribute to the advancement of synthetic strategies.
Used in the Synthesis of Carboxyamycin:
2-Benzyloxyphenylmagnesium bromide, 1M solution, is used as a substrate in one of the key synthetic steps for the total synthesis of an antibiotic called carboxyamycin. Its role in this process is to facilitate the formation of specific molecular structures that are crucial for the antibiotic's activity.
Used in Iron-Catalyzed Coupling Reactions:
This organomagnesium compound is also used as a substrate in the iron-catalyzed coupling reaction of aryl Grignard reagents with unprotected bromophenols. The use of 2-Benzyloxyphenylmagnesium bromide, 1M solution, in this application is due to its compatibility with the iron catalyst and its ability to promote the desired coupling reaction.
Used in Cross-Coupling of Grignard Reagents:
2-Benzyloxyphenylmagnesium bromide, 1M solution, is utilized in the cross-coupling of Grignard reagents using diaryl titanates and ferric chloride. Its application in this process is attributed to its reactivity with Grignard reagents and its compatibility with the reaction conditions, leading to the formation of the desired product.
Check Digit Verification of cas no
The CAS Registry Mumber 328000-16-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,8,0,0 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 328000-16:
(8*3)+(7*2)+(6*8)+(5*0)+(4*0)+(3*0)+(2*1)+(1*6)=94
94 % 10 = 4
So 328000-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H11O.BrH.Mg/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;;/h1-9H,11H2;1H;/q;;+1/p-1/rC13H11BrMgO/c14-15-12-8-4-5-9-13(12)16-10-11-6-2-1-3-7-11/h1-9H,10H2
328000-16-4Relevant articles and documents
GLUCOPYRANOSYLOXYBENZYLBENZENE DERIVATIVES AND MEDICINAL USE THEREOF
-
Page 22, (2008/06/13)
The present invention provides glucopyranosyloxybenzylbenzene derivatives represented by the general formula: wherein P represents a hydrogen atom or a group forming a prodrug; R1 represents a hydrogen atom, an optionally substituted amino grou