40017-58-1 Usage
Description
2-Amino-3-(2-chlorobenzoyl)thiophene is an organic compound characterized by its chemical structure that features a thiophene ring with an amino group at the 2nd position and a 2-chlorobenzoyl group attached at the 3rd position. It is a yellow solid and is known for its utility in the synthesis of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
2-Amino-3-(2-chlorobenzoyl)thiophene is used as an intermediate in the synthesis of Brotizolam (B689280(M)), which is a hypnotic and sedative agent. Its role in the production process is crucial for creating the final compound that helps in inducing sleep and reducing anxiety.
Additionally, due to its chemical properties and structure, 2-Amino-3-(2-chlorobenzoyl)thiophene may have potential applications in other areas of the pharmaceutical industry, such as the development of new drugs with different therapeutic profiles. However, further research and development would be required to explore these possibilities.
Check Digit Verification of cas no
The CAS Registry Mumber 40017-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,0,1 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40017-58:
(7*4)+(6*0)+(5*0)+(4*1)+(3*7)+(2*5)+(1*8)=71
71 % 10 = 1
So 40017-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClNOS/c12-9-4-2-1-3-7(9)10(14)8-5-6-15-11(8)13/h1-6H,13H2
40017-58-1Relevant articles and documents
THE SYNTHESIS OF THIENOTRIAZOLOTHIAZEPINES
Nagaoka, Hitoshi,Hara, Hiromu,Mase, Toshiyasu
, p. 1241 - 1244 (2007/10/02)
Some derivatives of thienotriazolothiazepine, a novel heteroazepine, were synthesized.These compounds showed anti-PAF activity.