6106-41-8 Usage
Description
SODIUM VALERATE, also known as Valeric Acid Sodium Salt (CAS# 6106-41-8), is a white solid compound that is useful in organic synthesis. It is derived from valeric acid and has a significant role in various chemical reactions and applications due to its unique properties.
Uses
Used in Organic Synthesis:
SODIUM VALERATE is used as a synthetic intermediate for the production of various organic compounds. Its application in organic synthesis is due to its ability to facilitate chemical reactions and form new compounds with desired properties.
Used in Pharmaceutical Industry:
SODIUM VALERATE is used as a pharmaceutical compound for the development of drugs with specific therapeutic effects. Its role in the pharmaceutical industry is attributed to its potential to interact with biological systems and contribute to the treatment of various medical conditions.
Used in Chemical Research:
SODIUM VALERATE is used as a research compound in the field of chemistry. It is employed in various experiments and studies to understand its properties, reactivity, and potential applications in different chemical processes.
Used in Industrial Applications:
SODIUM VALERATE is used as a component in various industrial applications, such as the production of chemicals, materials, and other products. Its versatility and unique properties make it a valuable compound in the development of new technologies and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6106-41-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,0 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6106-41:
(6*6)+(5*1)+(4*0)+(3*6)+(2*4)+(1*1)=68
68 % 10 = 8
So 6106-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H10O2.Na/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1
6106-41-8Relevant articles and documents
PROCESSES FOR PREPARING 4-METHYL-5-NONANONE AND 4-METHYL-5-NONANOL
-
Paragraph 0171-0176, (2020/07/14)
The present invention provides a process for preparing 4-methyl-5-nonanone of the following formula (3), the process comprising at least a step of subjecting pentanoic anhydride of the following formula (1) and a 2-pentyl nucleophilic reagent of the following general formula (2), in which M represents Li, MgZ1, or ZnZ1, wherein Z1 represents a halogen atom or a 2-pentyl group, to a nucleophilic substitution reaction to produce 4-methyl-5-nonanone (3), as well as a process for preparing 4-methyl-5-nonanol of the following formula (7), the process comprising at least steps of preparing 4-methyl-5-nonanone and subjecting the obtained 4-methyl-5-nonanone and a reducing agent to a reduction reaction to produce 4-methyl-5-nonanol (7).
