723-61-5 Usage
Description
(1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde is a bicyclic compound with a six-membered ring and two aldehyde groups. It features a stereoisomeric configuration of (1R,5S,8-anti), which describes the arrangement of its asymmetric carbon atoms. (1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde also contains two methyl groups and an isopropyl group attached to the bicyclic ring. Its unique structure and reactivity make it a promising candidate for applications in organic synthesis and the pharmaceutical industry, and it is an interesting target for chemical research and development.
Uses
Used in Organic Synthesis:
(1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde is used as a key intermediate in organic synthesis for the production of various complex organic molecules. Its aldehyde groups and unique bicyclic structure allow for a wide range of chemical reactions, making it a versatile building block for the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde is used as a starting material for the development of new drugs. Its unique structure and reactivity can be exploited to design and synthesize novel drug candidates with potential therapeutic applications. (1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde's aldehyde groups can be used to form various functional groups, such as amines, alcohols, and esters, which can be incorporated into drug molecules to enhance their pharmacological properties.
Used in Chemical Research and Development:
(1R,5S,8-anti)-1,7-Dimethyl-4α-isopropylbicyclo[3.2.1]oct-6-ene-6,8-dicarbaldehyde is also used as a research tool in chemical research and development. Its unique structure and reactivity make it an interesting target for studying various chemical reactions and mechanisms. Researchers can use this compound to explore new synthetic methods, develop innovative catalysts, and investigate the properties of novel materials. Additionally, its potential applications in organic synthesis and the pharmaceutical industry make it a valuable subject for the development of new technologies and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 723-61-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,2 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 723-61:
(5*7)+(4*2)+(3*3)+(2*6)+(1*1)=65
65 % 10 = 5
So 723-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O2/c1-9(2)11-5-6-15(4)10(3)12(7-16)14(11)13(15)8-17/h7-9,11,13-14H,5-6H2,1-4H3
723-61-5Relevant articles and documents
TOTAL SYNTHESIS OF (+/-)-HELMINTHOSPORAL VIA FRAGMENTATION REACTION
Nagaoka, Hiroto,Baba, Atsuo,Yamada, Yasuji
, p. 6741 - 6744 (2007/10/02)
A new route for the total synthesis of (+/-)-helminthosporal ((+/-)-1), involving fragmentation reaction of tricyclo2,7>octane derivative 5 to give bicyclooctane derivative 6 as a crucial step, is described.