84803-67-8 Usage
Description
3-Amino-5-acetyliminodibenzyl is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its unique molecular structure, which features a dibenzyl backbone with an acetylimino group and an amino group attached to different positions. This versatile molecule plays a crucial role in the development of new drugs and materials.
Uses
Used in Pharmaceutical Industry:
3-Amino-5-acetyliminodibenzyl is used as a reagent in the synthesis of Bonnecor, a new antiarrhythmic drug. It plays a vital role in the production process, contributing to the drug's ability to regulate heart rhythm and treat arrhythmias.
In the synthesis of Bonnecor, 3-Amino-5-acetyliminodibenzyl acts as a crucial building block, enabling the formation of the desired molecular structure. Its presence in the synthesis process is essential for the development of this innovative antiarrhythmic medication, which aims to provide improved treatment options for patients suffering from heart rhythm disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 84803-67-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,8,0 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 84803-67:
(7*8)+(6*4)+(5*8)+(4*0)+(3*3)+(2*6)+(1*7)=148
148 % 10 = 8
So 84803-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H16N2O/c1-11(19)18-15-5-3-2-4-12(15)6-7-13-8-9-14(17)10-16(13)18/h2-5,8-10H,6-7,17H2,1H3
84803-67-8Relevant articles and documents
SELECTIVE INHIBITORS OF CONSTITUTIVE ANDROSTANE RECEPTOR
-
Paragraph 00554, (2016/05/24)
The compounds of the invention are antagonists of CAR, with specificity for CAR over other proteins including PXR. The disclosed compounds are useful in treating or controlling cell proliferative disorders, in particular oncological disorders, such as cancer. This abstract is intended as a scanning tool for purposes of searching in the particular art and is not intended to be limiting of the present invention.
