The CAS registry number of 5-Pyrimidinecarboxylicacid, sodium salt (1:1) is 352535-06-9. This chemical is also known as Sodium 5-pyrimidine carboxylate. The molecular formula of it is C5H3N2NaO2 and molecular weight is 146.07929. Its systematic name is called 5-Pyrimidinecarboxylic acid, sodium salt (1:1).
Physical properties about this chemical are: (1)#H bond acceptors: 4; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 1.
You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[O-]C(=O)c1cncnc1
(2)InChI: InChI=1/C5H4N2O2.Na/c8-5(9)4-1-6-3-7-2-4;/h1-3H,(H,8,9);/q;+1/p-1
(3)InChIKey: DHFGDBUDVXKBEC-REWHXWOFAY
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View