3-HYDROXYDODECANOIC ACID

The Dodecanoic acid,3-hydroxy-, with the CAS registry number 1883-13-2, is also known as DL-Beta-hydroxylauric acid. This chemical's molecular formula is C₁₂H₂₄O₃ and molecular weight is 216.32. What's more, its systematic name and its IUPAC name are the same which is called 3-Hydroxydodecanoic acid. Additionally, it should be preserved hermetically and put in a cool, dry place.

Physical properties about Dodecanoic acid,3-hydroxy-: (1)ACD/LogP: 3.11; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.87; (4)ACD/LogD (pH 7.4): 0.09; (5)ACD/BCF (pH 5.5): 7.89; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 67.92; (8)ACD/KOC (pH 7.4): 1.11; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 11; (12)Polar Surface Area: 35.53 Å²; (13)Index of Refraction: 1.466; (14)Molar Refractivity: 60.7 cm³; (15)Molar Volume: 219.1 cm³; (16)Surface Tension: 38.4 dyne/cm; (17)Density: 0.987 g/cm³; (18)Flash Point: 178.4 °C; (19)Enthalpy of Vaporization: 68.59 kJ/mol; (20)Boiling Point: 348 °C at 760 mmHg; (21)Vapour Pressure: 3.19E-06 mmHg at 25 °C.

Uses of Dodecanoic acid,3-hydroxy-: it is used to produce other chemicals. For example, it can react with Benzyl 2-amino-6-O-benzyloxymethyl-2-deoxy-4-O-(diphenoxyphosphinyl)-3-O-(2-tetradecylhexadecanoyl)-β-D-glucopyranoside to get 2-Tetradecyl-hexadecanoic acid 2-benzyloxy-6-benzyloxymethoxymethyl-5-(bis-phenoxy-phosphoryloxy)-3-(3-hydroxy-dodecanoylamino)-tetrahydro-pyran-4-yl ester. The reaction occurs with reagent 1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride and solvent CH₂Cl₂  at ambient temperature. The yield is 80 %.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(O)CC(O)CCCCCCCCC
(2) InChI: InChI=1/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)
(3) InChIKey: MUCMKTPAZLSKTL-UHFFFAOYAV