The systematic name of this chemical is methyl 3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate. With the CAS registry number 202195-67-3, it is also named as 2H-1,4-benzoxazine-6-carboxylic acid, 3,4-dihydro-3-oxo-, methyl ester. The product's categories are Benzomorpholines & Benzothiomorpholines; Esters. The formula is C10H9NO4 and the molecular weight is 207.18.
The other characteristics of Methyl 3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate can be summarized as: (1)ACD/LogP: 1.02; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.02; (4)ACD/LogD (pH 7.4): 1.02; (5)ACD/BCF (pH 5.5): 3.51; (6)ACD/BCF (pH 7.4): 3.51; (7)ACD/KOC (pH 5.5): 85.47; (8)ACD/KOC (pH 7.4): 85.47; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 55.84 Å2; (13)Index of Refraction: 1.555; (14)Molar Refractivity: 50.67 cm3; (15)Molar Volume: 157.7 cm3; (16)Polarizability: 20.08×10-24 cm3; (17)Surface Tension: 45.6 dyne/cm; (18)Density: 1.313 g/cm3; (19)Flash Point: 203.1 °C; (20)Enthalpy of Vaporization: 66.47 kJ/mol; (21)Boiling Point: 412.1 °C at 760 mmHg; (22)Vapour Pressure: 5.3E-07 mmHg at 25°C.
People can use the following data to convert to the molecule structure.
1. SMILES:O=C(OC)c2ccc1OCC(=O)Nc1c2
2. InChI:InChI=1/C10H9NO4/c1-14-10(13)6-2-3-8-7(4-6)11-9(12)5-15-8/h2-4H,5H2,1H3,(H,11,12)
3. InChIKey:WPGYGHFVLMZWHI-UHFFFAOYAQ
4. Std. InChI:InChI=1S/C10H9NO4/c1-14-10(13)6-2-3-8-7(4-6)11-9(12)5-15-8/h2-4H,5H2,1H3,(H,11,12)
5. Std. InChIKey:WPGYGHFVLMZWHI-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View