108412-04-0 Usage
Description
D-Allylglycine hydrochloride, also known as (R)-2-Aminopent-4-enoic acid hydrochloride, is an organic compound that serves as a valuable intermediate in various organic synthesis and research processes. It is characterized by its unique chemical structure and properties, which make it a versatile compound for different applications.
Uses
Used in Organic Synthesis:
D-Allylglycine hydrochloride is used as a key intermediate for the synthesis of various organic compounds. Its chemical structure allows it to be a building block in the creation of a wide range of molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research Processes:
In the field of research, D-Allylglycine hydrochloride is utilized as a starting material or a reagent in various chemical reactions and experiments. Its unique properties make it a valuable tool for understanding the mechanisms of different chemical processes and for developing new synthetic methods.
Used in Pharmaceutical Industry:
D-Allylglycine hydrochloride is used as an intermediate in the development of pharmaceutical compounds. Its role in the synthesis of various drugs makes it an essential component in the pharmaceutical industry, contributing to the creation of new medications and therapies.
Used in Agrochemical Industry:
In the agrochemical industry, D-Allylglycine hydrochloride is employed as a building block for the synthesis of various agrochemicals, such as pesticides and herbicides. Its versatility in organic synthesis allows for the development of new and improved products to enhance crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 108412-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,4,1 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 108412-04:
(8*1)+(7*0)+(6*8)+(5*4)+(4*1)+(3*2)+(2*0)+(1*4)=90
90 % 10 = 0
So 108412-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2.ClH/c1-2-3-4(6)5(7)8;/h2,4H,1,3,6H2,(H,7,8);1H/t4-;/m1./s1