13625-39-3 Usage
General Description
1,3,8-Triaza-spiro[4.5]decane-2,4-dione is a chemical compound with the molecular formula C7H10N2O2. It is a heterocyclic compound that belongs to the class of spiro compounds, which are characterized by a distinctive ring structure. This particular compound has a spiro ring incorporating a 1,3,8-triazaspiro[4.5]decane core with a 2,4-dione moiety, giving it unique properties and potential applications. It is used in pharmaceutical research and drug development as it has the potential to exhibit unique biological activities. Additionally, it may also be used in various chemical and industrial processes due to its specific chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 13625-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,2 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13625-39:
(7*1)+(6*3)+(5*6)+(4*2)+(3*5)+(2*3)+(1*9)=93
93 % 10 = 3
So 13625-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O2/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h8H,1-4H2,(H2,9,10,11,12)/p+1