136345-68-1 Usage
Description
D-Gulono-1,4-lactone 2,3,5,6-Tetraacetate is a white solid derivative of D-Gulono-1,4-lactone, which is a naturally occurring organic compound. It is characterized by its unique chemical structure and properties, making it a versatile compound for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
D-Gulono-1,4-lactone 2,3,5,6-Tetraacetate is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, D-Gulono-1,4-lactone 2,3,5,6-Tetraacetate serves as a key building block for the creation of complex organic molecules. Its versatile structure enables the synthesis of a wide range of compounds with diverse properties and applications.
Used in Research and Development:
D-Gulono-1,4-lactone 2,3,5,6-Tetraacetate is utilized as a research compound in various scientific studies. Its unique properties make it an interesting subject for exploring new chemical reactions, mechanisms, and potential applications in various fields.
Used in Analytical Chemistry:
As a white solid with distinct chemical properties, D-Gulono-1,4-lactone 2,3,5,6-Tetraacetate can be employed in analytical chemistry for the development of new methods and techniques for the identification and quantification of various compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 136345-68-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,3,4 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 136345-68:
(8*1)+(7*3)+(6*6)+(5*3)+(4*4)+(3*5)+(2*6)+(1*8)=131
131 % 10 = 1
So 136345-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H18O10/c1-6(15)20-5-10(21-7(2)16)11-12(22-8(3)17)13(14(19)24-11)23-9(4)18/h10-13H,5H2,1-4H3/t10-,11+,12-,13-/m1/s1
136345-68-1Relevant articles and documents
A simple synthesis of D-galactono-1,4-lactone and key building blocks for the preparation of galactofuranosides
De Talance, Vincent Lemau,Thiery, Emilie,Eppe, Guillaume,Bkassiny, Sandy El,Mortier, Jeremie,Vincent, Stephane P.
experimental part, p. 605 - 617 (2012/06/04)
The oxidation of D-galactose by Br2 to yield D-galactono-1,4-lactone was developed and applied to the preparation of key building blocks for the synthesis of galactofuranosides. Three D-galactono-1,4-lactone derivatives protected as acetates, TBDMS ether, or acetonide were directly obtained in two steps on multigram scale with only one purification step. A mild deacetylation methodology afforded pure D-galactono-1,4-lactone and a new reduction of the lactone functionality using K-selectride was also optimized.