1480-64-4 Usage
Description
3-Chloro-2-fluoro-pyridine is an organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing four carbon atoms and two nitrogen atoms. In this specific compound, one of the hydrogen atoms on the pyridine ring is replaced by a chlorine atom, and another hydrogen atom is replaced by a fluorine atom. This substitution gives 3-Chloro-2-fluoro-pyridine unique chemical properties and reactivity, making it a valuable intermediate in the synthesis of various compounds.
Uses
Used in Pharmaceutical Industry:
3-Chloro-2-fluoro-pyridine is used as a reactant in the synthesis of several compounds with therapeutic potential. Its unique structure allows for the development of new drugs with improved pharmacological properties, such as enhanced efficacy, selectivity, and reduced side effects. The compound can be utilized in the creation of novel therapeutic agents for the treatment of various diseases, including cancer, neurological disorders, and infectious diseases.
Used in Chemical Research:
3-Chloro-2-fluoro-pyridine is also used as a building block in chemical research, particularly in the field of heterocyclic chemistry. Its reactivity and structural diversity make it an attractive candidate for the synthesis of complex organic molecules with potential applications in various industries, such as materials science, agrochemistry, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 1480-64-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,8 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1480-64:
(6*1)+(5*4)+(4*8)+(3*0)+(2*6)+(1*4)=74
74 % 10 = 4
So 1480-64-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClFN/c6-4-2-1-3-8-5(4)7/h1-3H