15813-08-8 Usage
General Description
4-Methyl-5-bromoimidazole is a chemical compound that is commonly used in pharmaceutical and organic synthesis. It is a derivative of imidazole, which is a five-membered ring with two nitrogen atoms. 4-Methyl-5-bromoimidazole is often used as a building block in the synthesis of pharmaceuticals, agricultural chemicals, and other organic compounds. Its chemical structure consists of a methyl group and a bromine atom attached to an imidazole ring, giving it specific reactivity and properties that make it useful in various chemical reactions. 4-Methyl-5-bromoimidazole is also used as a precursor in the synthesis of various drugs and bioactive compounds, making it an important and versatile chemical in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 15813-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,1 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15813-08:
(7*1)+(6*5)+(5*8)+(4*1)+(3*3)+(2*0)+(1*8)=98
98 % 10 = 8
So 15813-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BrN2/c1-3-4(5)7-2-6-3/h2H,1H3,(H,6,7)