17584-12-2 Usage
Description
3-Amino-5,6-dimethyl-1,2,4-triazine is an organic compound characterized by its pink to yellow-beige crystalline powder form. It is known for its ability to participate in various chemical reactions, such as intramolecular cyclization and reactions with other compounds like silver trifluoromethane-sulfonate and benzoyl chloride.
Uses
Used in Chemical Synthesis:
3-Amino-5,6-dimethyl-1,2,4-triazine is used as a reactant in chemical synthesis for the formation of various compounds. Its reactivity with different agents allows for the creation of a wide range of products.
Used in Intramolecular Cyclization:
In the field of organic chemistry, 3-amino-5,6-dimethyl-1,2,4-triazine is used as a reactant in intramolecular cyclization reactions of various 1,2-bis(amidinohydrazone)s. This application is significant for the synthesis of complex molecular structures.
Used in the Formation of Coordination Compounds:
3-Amino-5,6-dimethyl-1,2,4-triazine is used as a ligand in the formation of coordination compounds, such as tris(3-amino-5,6-dimethyl-1,2,4-triazine-κN)silver(I) trifluromethane-sulfonate. This application is important in the field of coordination chemistry and materials science.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, due to its involvement in chemical synthesis and the formation of coordination compounds, 3-amino-5,6-dimethyl-1,2,4-triazine may have potential applications in the pharmaceutical industry for the development of new drugs and drug delivery systems.
Used in Research and Development:
3-Amino-5,6-dimethyl-1,2,4-triazine is also likely to be used in research and development settings, where its unique chemical properties can be explored for the creation of new materials, catalysts, or other advanced chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 17584-12-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,8 and 4 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 17584-12:
(7*1)+(6*7)+(5*5)+(4*8)+(3*4)+(2*1)+(1*2)=122
122 % 10 = 2
So 17584-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H8N4/c1-3-4(2)8-9-5(6)7-3/h1-2H3,(H2,6,7,9)
